C16H30O7Rf2-2 — CID 177273983
1-methanidyloxy-3-[2-(oxan-2-yloxy)-3-prop-2-enoxypropoxy]propan-2-ol;methanol;bis(rutherfordium) (PubChem CID 177273983) has the molecular formula C16H30O7Rf2-2 and a molecular weight of 868.41 g/mol. Its IUPAC name is 1-methanidyloxy-3-[2-(oxan-2-yloxy)-3-prop-2-enoxypropoxy]propan-2-ol;methanol;bis(rutherfordium).
| Compound Name | 1-methanidyloxy-3-[2-(oxan-2-yloxy)-3-prop-2-enoxypropoxy]propan-2-ol;methanol;bis(rutherfordium) |
|---|---|
| PubChem CID | 177273983 |
| Molecular Formula | C16H30O7Rf2-2 |
| Molecular Weight | 868.41 g/mol |
| Exact Mass | 868.44 |
| IUPAC Name | 1-methanidyloxy-3-[2-(oxan-2-yloxy)-3-prop-2-enoxypropoxy]propan-2-ol;methanol;bis(rutherfordium) |
| SMILES | C=CCOCC(COCC(O)CO[CH2-])OC1CCCCO1.[CH2-]O.[Rf].[Rf] |
| InChI | InChI=1S/C15H27O6.CH3O.2Rf/c1-3-7-18-11-14(12-19-10-13(16)9-17-2)21-15-6-4-5-8-20-15;1-2;;/h3,13-16H,1-2,4-12H2;2H,1H2;;/q2*-1;; |
| InChIKey | YDQFORUGRKSGFT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|