C24H44Cl4O8 — CID 163495898
1,3-bis(2-chloroethoxy)propan-2-ol;2-[1,3-bis(2-chloroethoxy)propan-2-yloxy]oxane;3,4-dihydro-2H-pyran (PubChem CID 163495898) has the molecular formula C24H44Cl4O8 and a molecular weight of 602.42 g/mol. Its IUPAC name is 1,3-bis(2-chloroethoxy)propan-2-ol;2-[1,3-bis(2-chloroethoxy)propan-2-yloxy]oxane;3,4-dihydro-2H-pyran.
| Compound Name | 1,3-bis(2-chloroethoxy)propan-2-ol;2-[1,3-bis(2-chloroethoxy)propan-2-yloxy]oxane;3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 163495898 |
| Molecular Formula | C24H44Cl4O8 |
| Molecular Weight | 602.42 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | 1,3-bis(2-chloroethoxy)propan-2-ol;2-[1,3-bis(2-chloroethoxy)propan-2-yloxy]oxane;3,4-dihydro-2H-pyran |
| SMILES | C1=COCCC1.ClCCOCC(COCCCl)OC1CCCCO1.OC(COCCCl)COCCCl |
| InChI | InChI=1S/C12H22Cl2O4.C7H14Cl2O3.C5H8O/c13-4-7-15-9-11(10-16-8-5-14)18-12-3-1-2-6-17-12;8-1-3-11-5-7(10)6-12-4-2-9;1-2-4-6-5-3-1/h11-12H,1-10H2;7,10H,1-6H2;2,4H,1,3,5H2 |
| InChIKey | CQRDCTKJIZKDHF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|