C20H43NO7P+ — CID 59440780
2-[[3-heptoxy-2-(oxan-2-yloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 59440780) has the molecular formula C20H43NO7P+ and a molecular weight of 440.54 g/mol. Its IUPAC name is 2-[[3-heptoxy-2-(oxan-2-yloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[3-heptoxy-2-(oxan-2-yloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 59440780 |
| Molecular Formula | C20H43NO7P+ |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 2-[[3-heptoxy-2-(oxan-2-yloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCOCC(COP(=O)(O)OCC[N+](C)(C)C)OC1CCCCO1 |
| InChI | InChI=1S/C20H42NO7P/c1-5-6-7-8-10-14-24-17-19(28-20-12-9-11-15-25-20)18-27-29(22,23)26-16-13-21(2,3)4/h19-20H,5-18H2,1-4H3/p+1 |
| InChIKey | HKJWLEBAJWXFKG-UHFFFAOYSA-O |
| XLogP | 3.72 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|