C19H42N2O7P+ — CID 10622969
2-[[(2R)-3-(6-aminohexoxy)-2-(oxan-2-yloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 10622969) has the molecular formula C19H42N2O7P+ and a molecular weight of 441.53 g/mol. Its IUPAC name is 2-[[(2R)-3-(6-aminohexoxy)-2-(oxan-2-yloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-3-(6-aminohexoxy)-2-(oxan-2-yloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 10622969 |
| Molecular Formula | C19H42N2O7P+ |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | 2-[[(2R)-3-(6-aminohexoxy)-2-(oxan-2-yloxy)propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOP(=O)(O)OC[C@@H](COCCCCCCN)OC1CCCCO1 |
| InChI | InChI=1S/C19H41N2O7P/c1-21(2,3)12-15-26-29(22,23)27-17-18(28-19-10-6-9-14-25-19)16-24-13-8-5-4-7-11-20/h18-19H,4-17,20H2,1-3H3/p+1/t18-,19?/m1/s1 |
| InChIKey | MEQHSYITPFTBOI-MRTLOADZSA-O |
| XLogP | 2.27 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|