C20H38O9Rf-2 — CID 177262177
1-methanidyloxy-3-[2-(oxan-2-yloxy)-3-[2-(oxan-2-yloxy)ethoxy]propoxy]propan-2-ol;methanol;rutherfordium (PubChem CID 177262177) has the molecular formula C20H38O9Rf-2 and a molecular weight of 689.51 g/mol. Its IUPAC name is 1-methanidyloxy-3-[2-(oxan-2-yloxy)-3-[2-(oxan-2-yloxy)ethoxy]propoxy]propan-2-ol;methanol;rutherfordium.
| Compound Name | 1-methanidyloxy-3-[2-(oxan-2-yloxy)-3-[2-(oxan-2-yloxy)ethoxy]propoxy]propan-2-ol;methanol;rutherfordium |
|---|---|
| PubChem CID | 177262177 |
| Molecular Formula | C20H38O9Rf-2 |
| Molecular Weight | 689.51 g/mol |
| Exact Mass | 689.37 |
| IUPAC Name | 1-methanidyloxy-3-[2-(oxan-2-yloxy)-3-[2-(oxan-2-yloxy)ethoxy]propoxy]propan-2-ol;methanol;rutherfordium |
| SMILES | [CH2-]O.[CH2-]OCC(O)COCC(COCCOC1CCCCO1)OC1CCCCO1.[Rf] |
| InChI | InChI=1S/C19H35O8.CH3O.Rf/c1-21-12-16(20)13-23-15-17(27-19-7-3-5-9-25-19)14-22-10-11-26-18-6-2-4-8-24-18;1-2;/h16-20H,1-15H2;2H,1H2;/q2*-1; |
| InChIKey | LEDLKZMZHDVKIN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.51 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|