C34H60Cl2N4O12 — CID 160595233
[2-[6-[(2-butanoyloxyacetyl)amino]hexylamino]-2-oxoethyl] butanoate;hexanedioyl dichloride;2-hydroxy-N-[6-[(2-hydroxyacetyl)amino]hexyl]acetamide (PubChem CID 160595233) has the molecular formula C34H60Cl2N4O12 and a molecular weight of 787.78 g/mol. Its IUPAC name is [2-[6-[(2-butanoyloxyacetyl)amino]hexylamino]-2-oxoethyl] butanoate;hexanedioyl dichloride;2-hydroxy-N-[6-[(2-hydroxyacetyl)amino]hexyl]acetamide.
| Compound Name | [2-[6-[(2-butanoyloxyacetyl)amino]hexylamino]-2-oxoethyl] butanoate;hexanedioyl dichloride;2-hydroxy-N-[6-[(2-hydroxyacetyl)amino]hexyl]acetamide |
|---|---|
| PubChem CID | 160595233 |
| Molecular Formula | C34H60Cl2N4O12 |
| Molecular Weight | 787.78 g/mol |
| Exact Mass | 786.36 |
| IUPAC Name | [2-[6-[(2-butanoyloxyacetyl)amino]hexylamino]-2-oxoethyl] butanoate;hexanedioyl dichloride;2-hydroxy-N-[6-[(2-hydroxyacetyl)amino]hexyl]acetamide |
| SMILES | CCCC(=O)OCC(=O)NCCCCCCNC(=O)COC(=O)CCC.O=C(CO)NCCCCCCNC(=O)CO.O=C(Cl)CCCCC(=O)Cl |
| InChI | InChI=1S/C18H32N2O6.C10H20N2O4.C6H8Cl2O2/c1-3-9-17(23)25-13-15(21)19-11-7-5-6-8-12-20-16(22)14-26-18(24)10-4-2;13-7-9(15)11-5-3-1-2-4-6-12-10(16)8-14;7-5(9)3-1-2-4-6(8)10/h3-14H2,1-2H3,(H,19,21)(H,20,22);13-14H,1-8H2,(H,11,15)(H,12,16);1-4H2 |
| InChIKey | RDNSIVCAARSTCN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 243.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.78 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|