About [2-[[(Z)-octadec-9-enyl]amino]-2-oxoethyl] 2-hydroxyacetate
[2-[[(Z)-octadec-9-enyl]amino]-2-oxoethyl] 2-hydroxyacetate (PubChem CID 87207736) has the molecular formula C22H41NO4
and a molecular weight of 383.57 g/mol. Its IUPAC name is [2-[[(Z)-octadec-9-enyl]amino]-2-oxoethyl] 2-hydroxyacetate.
Molecular Properties
| Compound Name | [2-[[(Z)-octadec-9-enyl]amino]-2-oxoethyl] 2-hydroxyacetate |
| PubChem CID | 87207736 |
| Molecular Formula | C22H41NO4 |
| Molecular Weight | 383.57 g/mol |
| Exact Mass | 383.30 |
| IUPAC Name | [2-[[(Z)-octadec-9-enyl]amino]-2-oxoethyl] 2-hydroxyacetate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCNC(=O)COC(=O)CO |
| InChI | InChI=1S/C22H41NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-21(25)20-27-22(26)19-24/h9-10,24H,2-8,11-20H2,1H3,(H,23,25)/b10-9- |
| InChIKey | OCWNMPQCEDAXIY-KTKRTIGZSA-N |
| XLogP | 4.68 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-[[(Z)-octadec-9-enyl]amino]-2-oxoethyl] 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[(Z)-octadec-9-enyl]amino]-2-oxoethyl] 2-hydroxyacetate?
The IUPAC name of [2-[[(Z)-octadec-9-enyl]amino]-2-oxoethyl] 2-hydroxyacetate (CID 87207736) is [2-[[(Z)-octadec-9-enyl]amino]-2-oxoethyl] 2-hydroxyacetate.
What is the SMILES notation for [2-[[(Z)-octadec-9-enyl]amino]-2-oxoethyl] 2-hydroxyacetate?
The canonical SMILES for [2-[[(Z)-octadec-9-enyl]amino]-2-oxoethyl] 2-hydroxyacetate is CCCCCCCC/C=C\CCCCCCCCNC(=O)COC(=O)CO.
What is the InChIKey of [2-[[(Z)-octadec-9-enyl]amino]-2-oxoethyl] 2-hydroxyacetate?
The InChIKey is OCWNMPQCEDAXIY-KTKRTIGZSA-N. The full InChI is InChI=1S/C22H41NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-21(25)20-27-22(26)19-24/h9-10,24H,2-8,11-20H2,1H3,(H,23,25)/b10-9-.
What are the key properties of [2-[[(Z)-octadec-9-enyl]amino]-2-oxoethyl] 2-hydroxyacetate?
[2-[[(Z)-octadec-9-enyl]amino]-2-oxoethyl] 2-hydroxyacetate has a molecular weight of 383.57 g/mol, XLogP of 4.68, 19 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[(Z)-octadec-9-enyl]amino]-2-oxoethyl] 2-hydroxyacetate is sourced from PubChem (CID 87207736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).