C40H56O12 — CID 160601943
(3-methoxy-2,2-dimethylpropyl) 4-(methoxymethyl)benzoate;2-methoxyethyl 4-(methoxymethyl)benzoate;3-methoxypropyl 4-(methoxymethyl)benzoate (PubChem CID 160601943) has the molecular formula C40H56O12 and a molecular weight of 728.88 g/mol. Its IUPAC name is (3-methoxy-2,2-dimethylpropyl) 4-(methoxymethyl)benzoate;2-methoxyethyl 4-(methoxymethyl)benzoate;3-methoxypropyl 4-(methoxymethyl)benzoate.
| Compound Name | (3-methoxy-2,2-dimethylpropyl) 4-(methoxymethyl)benzoate;2-methoxyethyl 4-(methoxymethyl)benzoate;3-methoxypropyl 4-(methoxymethyl)benzoate |
|---|---|
| PubChem CID | 160601943 |
| Molecular Formula | C40H56O12 |
| Molecular Weight | 728.88 g/mol |
| Exact Mass | 728.38 |
| IUPAC Name | (3-methoxy-2,2-dimethylpropyl) 4-(methoxymethyl)benzoate;2-methoxyethyl 4-(methoxymethyl)benzoate;3-methoxypropyl 4-(methoxymethyl)benzoate |
| SMILES | COCCCOC(=O)c1ccc(COC)cc1.COCCOC(=O)c1ccc(COC)cc1.COCc1ccc(C(=O)OCC(C)(C)COC)cc1 |
| InChI | InChI=1S/C15H22O4.C13H18O4.C12H16O4/c1-15(2,10-18-4)11-19-14(16)13-7-5-12(6-8-13)9-17-3;1-15-8-3-9-17-13(14)12-6-4-11(5-7-12)10-16-2;1-14-7-8-16-12(13)11-5-3-10(4-6-11)9-15-2/h5-8H,9-11H2,1-4H3;4-7H,3,8-10H2,1-2H3;3-6H,7-9H2,1-2H3 |
| InChIKey | REJRMXDNBGXSKW-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.88 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|