C20H32O7 — CID 160606085
butan-2-yl butan-2-yloxycarbonyl carbonate;2,7-dimethylocta-3,5-diyne-2,7-diol (PubChem CID 160606085) has the molecular formula C20H32O7 and a molecular weight of 384.47 g/mol. Its IUPAC name is butan-2-yl butan-2-yloxycarbonyl carbonate;2,7-dimethylocta-3,5-diyne-2,7-diol.
| Compound Name | butan-2-yl butan-2-yloxycarbonyl carbonate;2,7-dimethylocta-3,5-diyne-2,7-diol |
|---|---|
| PubChem CID | 160606085 |
| Molecular Formula | C20H32O7 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | butan-2-yl butan-2-yloxycarbonyl carbonate;2,7-dimethylocta-3,5-diyne-2,7-diol |
| SMILES | CC(C)(O)C#CC#CC(C)(C)O.CCC(C)OC(=O)OC(=O)OC(C)CC |
| InChI | InChI=1S/C10H18O5.C10H14O2/c1-5-7(3)13-9(11)15-10(12)14-8(4)6-2;1-9(2,11)7-5-6-8-10(3,4)12/h7-8H,5-6H2,1-4H3;11-12H,1-4H3 |
| InChIKey | REWQEZWLNNRONA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|