About [(2S)-butan-2-yl] cyclopropyl carbonate
[(2S)-butan-2-yl] cyclopropyl carbonate (PubChem CID 173085472) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is [(2S)-butan-2-yl] cyclopropyl carbonate.
Molecular Properties
| Compound Name | [(2S)-butan-2-yl] cyclopropyl carbonate |
| PubChem CID | 173085472 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | [(2S)-butan-2-yl] cyclopropyl carbonate |
| SMILES | CC[C@H](C)OC(=O)OC1CC1 |
| InChI | InChI=1S/C8H14O3/c1-3-6(2)10-8(9)11-7-4-5-7/h6-7H,3-5H2,1-2H3/t6-/m0/s1 |
| InChIKey | GGIHJHBQTPPKOC-LURJTMIESA-N |
| XLogP | 2.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-butan-2-yl] cyclopropyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-butan-2-yl] cyclopropyl carbonate?
The IUPAC name of [(2S)-butan-2-yl] cyclopropyl carbonate (CID 173085472) is [(2S)-butan-2-yl] cyclopropyl carbonate.
What is the SMILES notation for [(2S)-butan-2-yl] cyclopropyl carbonate?
The canonical SMILES for [(2S)-butan-2-yl] cyclopropyl carbonate is CC[C@H](C)OC(=O)OC1CC1.
What is the InChIKey of [(2S)-butan-2-yl] cyclopropyl carbonate?
The InChIKey is GGIHJHBQTPPKOC-LURJTMIESA-N. The full InChI is InChI=1S/C8H14O3/c1-3-6(2)10-8(9)11-7-4-5-7/h6-7H,3-5H2,1-2H3/t6-/m0/s1.
What are the key properties of [(2S)-butan-2-yl] cyclopropyl carbonate?
[(2S)-butan-2-yl] cyclopropyl carbonate has a molecular weight of 158.20 g/mol, XLogP of 2.10, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-butan-2-yl] cyclopropyl carbonate is sourced from PubChem (CID 173085472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).