About cyclopentyl 1-iodobutyl carbonate
cyclopentyl 1-iodobutyl carbonate (PubChem CID 86119197) has the molecular formula C10H17IO3
and a molecular weight of 312.15 g/mol. Its IUPAC name is cyclopentyl 1-iodobutyl carbonate.
Molecular Properties
| Compound Name | cyclopentyl 1-iodobutyl carbonate |
| PubChem CID | 86119197 |
| Molecular Formula | C10H17IO3 |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | cyclopentyl 1-iodobutyl carbonate |
| SMILES | CCCC(I)OC(=O)OC1CCCC1 |
| InChI | InChI=1S/C10H17IO3/c1-2-5-9(11)14-10(12)13-8-6-3-4-7-8/h8-9H,2-7H2,1H3 |
| InChIKey | PSNVUDPFIMUXRV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze cyclopentyl 1-iodobutyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl 1-iodobutyl carbonate?
The IUPAC name of cyclopentyl 1-iodobutyl carbonate (CID 86119197) is cyclopentyl 1-iodobutyl carbonate.
What is the SMILES notation for cyclopentyl 1-iodobutyl carbonate?
The canonical SMILES for cyclopentyl 1-iodobutyl carbonate is CCCC(I)OC(=O)OC1CCCC1.
What is the InChIKey of cyclopentyl 1-iodobutyl carbonate?
The InChIKey is PSNVUDPFIMUXRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17IO3/c1-2-5-9(11)14-10(12)13-8-6-3-4-7-8/h8-9H,2-7H2,1H3.
What are the key properties of cyclopentyl 1-iodobutyl carbonate?
cyclopentyl 1-iodobutyl carbonate has a molecular weight of 312.15 g/mol, XLogP of 3.64, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl 1-iodobutyl carbonate is sourced from PubChem (CID 86119197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).