C12H20N4O5 — CID 160606472
1-(dimethylamino)pyrrole-2,5-dione;4-(2,2-dimethylhydrazinyl)-4-oxobutanoic acid (PubChem CID 160606472) has the molecular formula C12H20N4O5 and a molecular weight of 300.32 g/mol. Its IUPAC name is 1-(dimethylamino)pyrrole-2,5-dione;4-(2,2-dimethylhydrazinyl)-4-oxobutanoic acid.
| Compound Name | 1-(dimethylamino)pyrrole-2,5-dione;4-(2,2-dimethylhydrazinyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 160606472 |
| Molecular Formula | C12H20N4O5 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1-(dimethylamino)pyrrole-2,5-dione;4-(2,2-dimethylhydrazinyl)-4-oxobutanoic acid |
| SMILES | CN(C)N1C(=O)C=CC1=O.CN(C)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C6H12N2O3.C6H8N2O2/c1-8(2)7-5(9)3-4-6(10)11;1-7(2)8-5(9)3-4-6(8)10/h3-4H2,1-2H3,(H,7,9)(H,10,11);3-4H,1-2H3 |
| InChIKey | REXYXODFLNRKRY-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|