About 4-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]amino]-4-oxobutanoic acid
4-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]amino]-4-oxobutanoic acid (PubChem CID 162720758) has the molecular formula C16H19N5O7
and a molecular weight of 393.36 g/mol. Its IUPAC name is 4-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]amino]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]amino]-4-oxobutanoic acid |
| PubChem CID | 162720758 |
| Molecular Formula | C16H19N5O7 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 4-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N(NCCN1C(=O)C=CC1=O)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H19N5O7/c22-11-1-2-12(23)19(11)9-7-17-21(15(26)5-6-16(27)28)18-8-10-20-13(24)3-4-14(20)25/h1-4,17-18H,5-10H2,(H,27,28) |
| InChIKey | LJZRIFQFQZPEKJ-UHFFFAOYSA-N |
| XLogP | -2.46 |
| TPSA | 156.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]amino]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]amino]-4-oxobutanoic acid?
The IUPAC name of 4-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]amino]-4-oxobutanoic acid (CID 162720758) is 4-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]amino]-4-oxobutanoic acid.
What is the SMILES notation for 4-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]amino]-4-oxobutanoic acid?
The canonical SMILES for 4-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]amino]-4-oxobutanoic acid is O=C(O)CCC(=O)N(NCCN1C(=O)C=CC1=O)NCCN1C(=O)C=CC1=O.
What is the InChIKey of 4-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]amino]-4-oxobutanoic acid?
The InChIKey is LJZRIFQFQZPEKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N5O7/c22-11-1-2-12(23)19(11)9-7-17-21(15(26)5-6-16(27)28)18-8-10-20-13(24)3-4-14(20)25/h1-4,17-18H,5-10H2,(H,27,28).
What are the key properties of 4-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]amino]-4-oxobutanoic acid?
4-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]amino]-4-oxobutanoic acid has a molecular weight of 393.36 g/mol, XLogP of -2.46, 11 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[bis[2-(2,5-dioxopyrrol-1-yl)ethylamino]amino]-4-oxobutanoic acid is sourced from PubChem (CID 162720758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).