C15H19N3O6 — CID 134298277
4-[2-(2,5-dioxopyrrol-1-yl)ethyl-[2-(prop-2-enoylamino)ethyl]amino]-4-oxobutanoic acid (PubChem CID 134298277) has the molecular formula C15H19N3O6 and a molecular weight of 337.33 g/mol. Its IUPAC name is 4-[2-(2,5-dioxopyrrol-1-yl)ethyl-[2-(prop-2-enoylamino)ethyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[2-(2,5-dioxopyrrol-1-yl)ethyl-[2-(prop-2-enoylamino)ethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 134298277 |
| Molecular Formula | C15H19N3O6 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 4-[2-(2,5-dioxopyrrol-1-yl)ethyl-[2-(prop-2-enoylamino)ethyl]amino]-4-oxobutanoic acid |
| SMILES | C=CC(=O)NCCN(CCN1C(=O)C=CC1=O)C(=O)CCC(=O)O |
| InChI | InChI=1S/C15H19N3O6/c1-2-11(19)16-7-8-17(12(20)5-6-15(23)24)9-10-18-13(21)3-4-14(18)22/h2-4H,1,5-10H2,(H,16,19)(H,23,24) |
| InChIKey | SUGJICAKGPHMSX-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|