C11H17N3O6S — CID 118423956
4-[3-(2,5-dioxopyrrol-1-yl)propylsulfamoylamino]butanoic acid (PubChem CID 118423956) has the molecular formula C11H17N3O6S and a molecular weight of 319.34 g/mol. Its IUPAC name is 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfamoylamino]butanoic acid.
| Compound Name | 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfamoylamino]butanoic acid |
|---|---|
| PubChem CID | 118423956 |
| Molecular Formula | C11H17N3O6S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNS(=O)(=O)NCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H17N3O6S/c15-9-4-5-10(16)14(9)8-2-7-13-21(19,20)12-6-1-3-11(17)18/h4-5,12-13H,1-3,6-8H2,(H,17,18) |
| InChIKey | UYRVXRKEEDWJFJ-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|