C12H17N3O7 — CID 87475313
4-(2,5-dioxopyrrol-1-yl)butanoic acid;N'-hydroxybutanediamide (PubChem CID 87475313) has the molecular formula C12H17N3O7 and a molecular weight of 315.28 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)butanoic acid;N'-hydroxybutanediamide.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)butanoic acid;N'-hydroxybutanediamide |
|---|---|
| PubChem CID | 87475313 |
| Molecular Formula | C12H17N3O7 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)butanoic acid;N'-hydroxybutanediamide |
| SMILES | NC(=O)CCC(=O)NO.O=C(O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C8H9NO4.C4H8N2O3/c10-6-3-4-7(11)9(6)5-1-2-8(12)13;5-3(7)1-2-4(8)6-9/h3-4H,1-2,5H2,(H,12,13);9H,1-2H2,(H2,5,7)(H,6,8) |
| InChIKey | ULPHNJQCJGGPNO-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|