C12H14N2O6 — CID 89253648
(4-oxobutanoylamino) 4-(2,5-dioxopyrrol-1-yl)butanoate (PubChem CID 89253648) has the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. Its IUPAC name is (4-oxobutanoylamino) 4-(2,5-dioxopyrrol-1-yl)butanoate.
| Compound Name | (4-oxobutanoylamino) 4-(2,5-dioxopyrrol-1-yl)butanoate |
|---|---|
| PubChem CID | 89253648 |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (4-oxobutanoylamino) 4-(2,5-dioxopyrrol-1-yl)butanoate |
| SMILES | O=CCCC(=O)NOC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H14N2O6/c15-8-2-3-9(16)13-20-12(19)4-1-7-14-10(17)5-6-11(14)18/h5-6,8H,1-4,7H2,(H,13,16) |
| InChIKey | KBCPSCYVSQGELQ-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|