C11H12N2O6 — CID 146723044
(2,5-dioxopyrrolidin-1-yl) 3-[[(Z)-4-oxobut-2-enoyl]amino]propanoate (PubChem CID 146723044) has the molecular formula C11H12N2O6 and a molecular weight of 268.22 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[[(Z)-4-oxobut-2-enoyl]amino]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[[(Z)-4-oxobut-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 146723044 |
| Molecular Formula | C11H12N2O6 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[[(Z)-4-oxobut-2-enoyl]amino]propanoate |
| SMILES | O=C/C=C\C(=O)NCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C11H12N2O6/c14-7-1-2-8(15)12-6-5-11(18)19-13-9(16)3-4-10(13)17/h1-2,7H,3-6H2,(H,12,15)/b2-1- |
| InChIKey | RFIXXUQWUQJWPH-UPHRSURJSA-N |
| XLogP | -1.14 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|