C12H16N2O6 — CID 87534030
(4-oxobutanoylamino) 4-[[(Z)-4-oxobut-2-enoyl]amino]butanoate (PubChem CID 87534030) has the molecular formula C12H16N2O6 and a molecular weight of 284.27 g/mol. Its IUPAC name is (4-oxobutanoylamino) 4-[[(Z)-4-oxobut-2-enoyl]amino]butanoate.
| Compound Name | (4-oxobutanoylamino) 4-[[(Z)-4-oxobut-2-enoyl]amino]butanoate |
|---|---|
| PubChem CID | 87534030 |
| Molecular Formula | C12H16N2O6 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (4-oxobutanoylamino) 4-[[(Z)-4-oxobut-2-enoyl]amino]butanoate |
| SMILES | O=C/C=C\C(=O)NCCCC(=O)ONC(=O)CCC=O |
| InChI | InChI=1S/C12H16N2O6/c15-8-2-4-10(17)13-7-1-6-12(19)20-14-11(18)5-3-9-16/h2,4,8-9H,1,3,5-7H2,(H,13,17)(H,14,18)/b4-2- |
| InChIKey | XEOTZNWRVMKWBT-RQOWECAXSA-N |
| XLogP | -0.81 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|