C11H14N2O6 — CID 170766080
(4-oxobutanoylamino) 3-[[(Z)-4-oxobut-2-enoyl]amino]propanoate (PubChem CID 170766080) has the molecular formula C11H14N2O6 and a molecular weight of 270.24 g/mol. Its IUPAC name is (4-oxobutanoylamino) 3-[[(Z)-4-oxobut-2-enoyl]amino]propanoate.
| Compound Name | (4-oxobutanoylamino) 3-[[(Z)-4-oxobut-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 170766080 |
| Molecular Formula | C11H14N2O6 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (4-oxobutanoylamino) 3-[[(Z)-4-oxobut-2-enoyl]amino]propanoate |
| SMILES | O=C/C=C\C(=O)NCCC(=O)ONC(=O)CCC=O |
| InChI | InChI=1S/C11H14N2O6/c14-7-1-3-9(16)12-6-5-11(18)19-13-10(17)4-2-8-15/h1,3,7-8H,2,4-6H2,(H,12,16)(H,13,17)/b3-1- |
| InChIKey | DKFZLUDVDGGUPS-IWQZZHSRSA-N |
| XLogP | -1.20 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|