C12H15N3O6 — CID 139935555
[(4-amino-4-oxobutanoyl)amino] 4-(2,5-dioxopyrrol-1-yl)butanoate (PubChem CID 139935555) has the molecular formula C12H15N3O6 and a molecular weight of 297.27 g/mol. Its IUPAC name is [(4-amino-4-oxobutanoyl)amino] 4-(2,5-dioxopyrrol-1-yl)butanoate.
| Compound Name | [(4-amino-4-oxobutanoyl)amino] 4-(2,5-dioxopyrrol-1-yl)butanoate |
|---|---|
| PubChem CID | 139935555 |
| Molecular Formula | C12H15N3O6 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | [(4-amino-4-oxobutanoyl)amino] 4-(2,5-dioxopyrrol-1-yl)butanoate |
| SMILES | NC(=O)CCC(=O)NOC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H15N3O6/c13-8(16)3-4-9(17)14-21-12(20)2-1-7-15-10(18)5-6-11(15)19/h5-6H,1-4,7H2,(H2,13,16)(H,14,17) |
| InChIKey | AWGTYLIIWAMRMK-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|