C14H19N3O6 — CID 58629999
(2,5-dioxopyrrol-1-yl) 4-[2-(2-methylpropanoylamino)ethylamino]-4-oxobutanoate (PubChem CID 58629999) has the molecular formula C14H19N3O6 and a molecular weight of 325.32 g/mol. Its IUPAC name is (2,5-dioxopyrrol-1-yl) 4-[2-(2-methylpropanoylamino)ethylamino]-4-oxobutanoate.
| Compound Name | (2,5-dioxopyrrol-1-yl) 4-[2-(2-methylpropanoylamino)ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 58629999 |
| Molecular Formula | C14H19N3O6 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (2,5-dioxopyrrol-1-yl) 4-[2-(2-methylpropanoylamino)ethylamino]-4-oxobutanoate |
| SMILES | CC(C)C(=O)NCCNC(=O)CCC(=O)ON1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H19N3O6/c1-9(2)14(22)16-8-7-15-10(18)3-6-13(21)23-17-11(19)4-5-12(17)20/h4-5,9H,3,6-8H2,1-2H3,(H,15,18)(H,16,22) |
| InChIKey | RQPAAXILIBJNOH-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|