C10H13N3O5 — CID 89054837
[2-(2,5-dioxopyrrol-1-yl)ethylamino] 4-amino-4-oxobutanoate (PubChem CID 89054837) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is [2-(2,5-dioxopyrrol-1-yl)ethylamino] 4-amino-4-oxobutanoate.
| Compound Name | [2-(2,5-dioxopyrrol-1-yl)ethylamino] 4-amino-4-oxobutanoate |
|---|---|
| PubChem CID | 89054837 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | [2-(2,5-dioxopyrrol-1-yl)ethylamino] 4-amino-4-oxobutanoate |
| SMILES | NC(=O)CCC(=O)ONCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H13N3O5/c11-7(14)1-4-10(17)18-12-5-6-13-8(15)2-3-9(13)16/h2-3,12H,1,4-6H2,(H2,11,14) |
| InChIKey | HYZPBVLDVFFDPX-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|