C9H12N2O4 — CID 175387478
[2-(2,5-dioxopyrrol-1-yl)ethylamino] propanoate (PubChem CID 175387478) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is [2-(2,5-dioxopyrrol-1-yl)ethylamino] propanoate.
| Compound Name | [2-(2,5-dioxopyrrol-1-yl)ethylamino] propanoate |
|---|---|
| PubChem CID | 175387478 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | [2-(2,5-dioxopyrrol-1-yl)ethylamino] propanoate |
| SMILES | CCC(=O)ONCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H12N2O4/c1-2-9(14)15-10-5-6-11-7(12)3-4-8(11)13/h3-4,10H,2,5-6H2,1H3 |
| InChIKey | WVCSIXORKQMKKQ-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|