C9H11F3N2O4 — CID 158113829
1-(2-aminoethyl)pyrrole-2,5-dione;trifluoromethyl acetate (PubChem CID 158113829) has the molecular formula C9H11F3N2O4 and a molecular weight of 268.19 g/mol. Its IUPAC name is 1-(2-aminoethyl)pyrrole-2,5-dione;trifluoromethyl acetate.
| Compound Name | 1-(2-aminoethyl)pyrrole-2,5-dione;trifluoromethyl acetate |
|---|---|
| PubChem CID | 158113829 |
| Molecular Formula | C9H11F3N2O4 |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 1-(2-aminoethyl)pyrrole-2,5-dione;trifluoromethyl acetate |
| SMILES | CC(=O)OC(F)(F)F.NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C6H8N2O2.C3H3F3O2/c7-3-4-8-5(9)1-2-6(8)10;1-2(7)8-3(4,5)6/h1-2H,3-4,7H2;1H3 |
| InChIKey | FQTJENFQTCWWJU-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|