C9H13N3O4S — CID 88563217
3-(2,5-dioxopyrrol-1-yl)-N-[2-(sulfanyloxyamino)ethyl]propanamide (PubChem CID 88563217) has the molecular formula C9H13N3O4S and a molecular weight of 259.29 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[2-(sulfanyloxyamino)ethyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-(sulfanyloxyamino)ethyl]propanamide |
|---|---|
| PubChem CID | 88563217 |
| Molecular Formula | C9H13N3O4S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-(sulfanyloxyamino)ethyl]propanamide |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCNOS |
| InChI | InChI=1S/C9H13N3O4S/c13-7(10-4-5-11-16-17)3-6-12-8(14)1-2-9(12)15/h1-2,11,17H,3-6H2,(H,10,13) |
| InChIKey | WGUZANUZFLFNDY-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|