C10H13N3O3S2 — CID 20755662
3-(2,5-dioxopyrrol-1-yl)-N-[2-(dithiiran-3-ylamino)ethyl]propanamide (PubChem CID 20755662) has the molecular formula C10H13N3O3S2 and a molecular weight of 287.37 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[2-(dithiiran-3-ylamino)ethyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-(dithiiran-3-ylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 20755662 |
| Molecular Formula | C10H13N3O3S2 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-(dithiiran-3-ylamino)ethyl]propanamide |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCNC1SS1 |
| InChI | InChI=1S/C10H13N3O3S2/c14-7(11-4-5-12-10-17-18-10)3-6-13-8(15)1-2-9(13)16/h1-2,10,12H,3-6H2,(H,11,14) |
| InChIKey | RQEZNIHFJSJYLU-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|