C10H16N4O4 — CID 23526547
N-[2-(aminomethoxyamino)ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide (PubChem CID 23526547) has the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is N-[2-(aminomethoxyamino)ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide.
| Compound Name | N-[2-(aminomethoxyamino)ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide |
|---|---|
| PubChem CID | 23526547 |
| Molecular Formula | C10H16N4O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N-[2-(aminomethoxyamino)ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide |
| SMILES | NCONCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H16N4O4/c11-7-18-13-5-4-12-8(15)3-6-14-9(16)1-2-10(14)17/h1-2,13H,3-7,11H2,(H,12,15) |
| InChIKey | RPHBVIOQHSDTKS-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|