C11H20N4O2 — CID 91552481
1-[3-[2-(2-aminoethylamino)ethylamino]propyl]pyrrole-2,5-dione (PubChem CID 91552481) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 1-[3-[2-(2-aminoethylamino)ethylamino]propyl]pyrrole-2,5-dione.
| Compound Name | 1-[3-[2-(2-aminoethylamino)ethylamino]propyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 91552481 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 1-[3-[2-(2-aminoethylamino)ethylamino]propyl]pyrrole-2,5-dione |
| SMILES | NCCNCCNCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H20N4O2/c12-4-6-14-8-7-13-5-1-9-15-10(16)2-3-11(15)17/h2-3,13-14H,1,4-9,12H2 |
| InChIKey | LUVSUUJBMAPVEN-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|