C9H13N3O4 — CID 23558129
3-(2,5-dioxopyrrol-1-yl)-N-[2-(hydroxyamino)ethyl]propanamide (PubChem CID 23558129) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[2-(hydroxyamino)ethyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-(hydroxyamino)ethyl]propanamide |
|---|---|
| PubChem CID | 23558129 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-(hydroxyamino)ethyl]propanamide |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCNO |
| InChI | InChI=1S/C9H13N3O4/c13-7(10-4-5-11-16)3-6-12-8(14)1-2-9(12)15/h1-2,11,16H,3-6H2,(H,10,13) |
| InChIKey | QFGGRVMGWPWORV-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|