C10H15N3O4 — CID 20710717
3-(2,5-dioxopyrrol-1-yl)-N-[2-(methoxyamino)ethyl]propanamide (PubChem CID 20710717) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[2-(methoxyamino)ethyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-(methoxyamino)ethyl]propanamide |
|---|---|
| PubChem CID | 20710717 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-(methoxyamino)ethyl]propanamide |
| SMILES | CONCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H15N3O4/c1-17-12-6-5-11-8(14)4-7-13-9(15)2-3-10(13)16/h2-3,12H,4-7H2,1H3,(H,11,14) |
| InChIKey | XBXXDWYGWKHXIE-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|