C10H10F3N3O5 — CID 156711375
[(2-aminoacetyl)-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino] 2,2,2-trifluoroacetate (PubChem CID 156711375) has the molecular formula C10H10F3N3O5 and a molecular weight of 309.20 g/mol. Its IUPAC name is [(2-aminoacetyl)-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [(2-aminoacetyl)-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 156711375 |
| Molecular Formula | C10H10F3N3O5 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | [(2-aminoacetyl)-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino] 2,2,2-trifluoroacetate |
| SMILES | NCC(=O)N(CCN1C(=O)C=CC1=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H10F3N3O5/c11-10(12,13)9(20)21-16(8(19)5-14)4-3-15-6(17)1-2-7(15)18/h1-2H,3-5,14H2 |
| InChIKey | CGUBXJVJHJYSMT-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|