C10H10F6N2O6 — CID 172816872
1-(2-aminoethyl)pyrrole-2,5-dione;bis(2,2,2-trifluoroacetic acid) (PubChem CID 172816872) has the molecular formula C10H10F6N2O6 and a molecular weight of 368.19 g/mol. Its IUPAC name is 1-(2-aminoethyl)pyrrole-2,5-dione;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-(2-aminoethyl)pyrrole-2,5-dione;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 172816872 |
| Molecular Formula | C10H10F6N2O6 |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 1-(2-aminoethyl)pyrrole-2,5-dione;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NCCN1C(=O)C=CC1=O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C6H8N2O2.2C2HF3O2/c7-3-4-8-5(9)1-2-6(8)10;2*3-2(4,5)1(6)7/h1-2H,3-4,7H2;2*(H,6,7) |
| InChIKey | SXRCKKZKXAHZJY-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|