C11H13N3O6 — CID 174705364
[(4-amino-4-oxobutanoyl)amino] 3-(2,5-dioxopyrrol-1-yl)propanoate (PubChem CID 174705364) has the molecular formula C11H13N3O6 and a molecular weight of 283.24 g/mol. Its IUPAC name is [(4-amino-4-oxobutanoyl)amino] 3-(2,5-dioxopyrrol-1-yl)propanoate.
| Compound Name | [(4-amino-4-oxobutanoyl)amino] 3-(2,5-dioxopyrrol-1-yl)propanoate |
|---|---|
| PubChem CID | 174705364 |
| Molecular Formula | C11H13N3O6 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | [(4-amino-4-oxobutanoyl)amino] 3-(2,5-dioxopyrrol-1-yl)propanoate |
| SMILES | NC(=O)CCC(=O)NOC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H13N3O6/c12-7(15)1-2-8(16)13-20-11(19)5-6-14-9(17)3-4-10(14)18/h3-4H,1-2,5-6H2,(H2,12,15)(H,13,16) |
| InChIKey | UNINOPNMDDNAEM-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|