C13H13N3O6 — CID 87930241
acetonitrile;(2,5-dioxopyrrolidin-1-yl) 3-(2,5-dioxopyrrol-1-yl)propanoate (PubChem CID 87930241) has the molecular formula C13H13N3O6 and a molecular weight of 307.26 g/mol. Its IUPAC name is acetonitrile;(2,5-dioxopyrrolidin-1-yl) 3-(2,5-dioxopyrrol-1-yl)propanoate.
| Compound Name | acetonitrile;(2,5-dioxopyrrolidin-1-yl) 3-(2,5-dioxopyrrol-1-yl)propanoate |
|---|---|
| PubChem CID | 87930241 |
| Molecular Formula | C13H13N3O6 |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | acetonitrile;(2,5-dioxopyrrolidin-1-yl) 3-(2,5-dioxopyrrol-1-yl)propanoate |
| SMILES | CC#N.O=C(CCN1C(=O)C=CC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C11H10N2O6.C2H3N/c14-7-1-2-8(15)12(7)6-5-11(18)19-13-9(16)3-4-10(13)17;1-2-3/h1-2H,3-6H2;1H3 |
| InChIKey | GZGXXLPENBCEHQ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 124.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|