C17H20N4O8 — CID 88897196
(2,5-dioxopyrrolidin-1-yl) 3-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propanoylamino]propanoate (PubChem CID 88897196) has the molecular formula C17H20N4O8 and a molecular weight of 408.37 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propanoylamino]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propanoylamino]propanoate |
|---|---|
| PubChem CID | 88897196 |
| Molecular Formula | C17H20N4O8 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propanoylamino]propanoate |
| SMILES | O=C(CCNC(=O)CCN1C(=O)C=CC1=O)NCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C17H20N4O8/c22-11(19-9-6-17(28)29-21-15(26)3-4-16(21)27)5-8-18-12(23)7-10-20-13(24)1-2-14(20)25/h1-2H,3-10H2,(H,18,23)(H,19,22) |
| InChIKey | CQGNOPMYTCZEEE-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 159.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|