C17H21N3O9 — CID 90324115
(2,5-dioxopyrrolidin-1-yl) 2-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]ethyl carbonate (PubChem CID 90324115) has the molecular formula C17H21N3O9 and a molecular weight of 411.37 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]ethyl carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]ethyl carbonate |
|---|---|
| PubChem CID | 90324115 |
| Molecular Formula | C17H21N3O9 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]ethyl carbonate |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCCOCCOC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C17H21N3O9/c21-12(6-8-19-13(22)2-3-14(19)23)18-7-1-9-27-10-11-28-17(26)29-20-15(24)4-5-16(20)25/h2-3H,1,4-11H2,(H,18,21) |
| InChIKey | VXYNFAAZXZRYSZ-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|