C8H8NO4- — CID 22907752
4-(2,5-dioxopyrrol-1-yl)butanoate (PubChem CID 22907752) has the molecular formula C8H8NO4- and a molecular weight of 182.16 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)butanoate.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)butanoate |
|---|---|
| PubChem CID | 22907752 |
| Molecular Formula | C8H8NO4- |
| Molecular Weight | 182.16 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)butanoate |
| SMILES | O=C([O-])CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C8H9NO4/c10-6-3-4-7(11)9(6)5-1-2-8(12)13/h3-4H,1-2,5H2,(H,12,13)/p-1 |
| InChIKey | NCPQROHLJFARLL-UHFFFAOYSA-M |
| XLogP | -1.56 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.16 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|