C9H11NO4 — CID 11629774
methyl 4-(2,5-dioxopyrrol-1-yl)butanoate (PubChem CID 11629774) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is methyl 4-(2,5-dioxopyrrol-1-yl)butanoate.
| Compound Name | methyl 4-(2,5-dioxopyrrol-1-yl)butanoate |
|---|---|
| PubChem CID | 11629774 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | methyl 4-(2,5-dioxopyrrol-1-yl)butanoate |
| SMILES | COC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H11NO4/c1-14-9(13)3-2-6-10-7(11)4-5-8(10)12/h4-5H,2-3,6H2,1H3 |
| InChIKey | WFBGVOMBEJAXOG-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|