C16H30N2O5 — CID 144648049
ethane;[methyl(4-oxobutanoyl)amino] acetate;1-methyl-2H-pyrrol-5-one (PubChem CID 144648049) has the molecular formula C16H30N2O5 and a molecular weight of 330.43 g/mol. Its IUPAC name is ethane;[methyl(4-oxobutanoyl)amino] acetate;1-methyl-2H-pyrrol-5-one.
| Compound Name | ethane;[methyl(4-oxobutanoyl)amino] acetate;1-methyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 144648049 |
| Molecular Formula | C16H30N2O5 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | ethane;[methyl(4-oxobutanoyl)amino] acetate;1-methyl-2H-pyrrol-5-one |
| SMILES | CC.CC.CC(=O)ON(C)C(=O)CCC=O.CN1CC=CC1=O |
| InChI | InChI=1S/C7H11NO4.C5H7NO.2C2H6/c1-6(10)12-8(2)7(11)4-3-5-9;1-6-4-2-3-5(6)7;2*1-2/h5H,3-4H2,1-2H3;2-3H,4H2,1H3;2*1-2H3 |
| InChIKey | NXFCKJSTJIGPOA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|