C14H22N2O6 — CID 144980202
[methyl(4-oxobutanoyl)amino] formate;(Z)-N-methyl-4-oxo-N-propylbut-2-enamide (PubChem CID 144980202) has the molecular formula C14H22N2O6 and a molecular weight of 314.34 g/mol. Its IUPAC name is [methyl(4-oxobutanoyl)amino] formate;(Z)-N-methyl-4-oxo-N-propylbut-2-enamide.
| Compound Name | [methyl(4-oxobutanoyl)amino] formate;(Z)-N-methyl-4-oxo-N-propylbut-2-enamide |
|---|---|
| PubChem CID | 144980202 |
| Molecular Formula | C14H22N2O6 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | [methyl(4-oxobutanoyl)amino] formate;(Z)-N-methyl-4-oxo-N-propylbut-2-enamide |
| SMILES | CCCN(C)C(=O)/C=C\C=O.CN(OC=O)C(=O)CCC=O |
| InChI | InChI=1S/C8H13NO2.C6H9NO4/c1-3-6-9(2)8(11)5-4-7-10;1-7(11-5-9)6(10)3-2-4-8/h4-5,7H,3,6H2,1-2H3;4-5H,2-3H2,1H3/b5-4-; |
| InChIKey | CHJZSFNYENLEFV-MKWAYWHRSA-N |
| XLogP | 0.12 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|