C17H28N2O6 — CID 155715085
butanedial;dimethylamino formate;1-hexylpyrrole-2,5-dione (PubChem CID 155715085) has the molecular formula C17H28N2O6 and a molecular weight of 356.42 g/mol. Its IUPAC name is butanedial;dimethylamino formate;1-hexylpyrrole-2,5-dione.
| Compound Name | butanedial;dimethylamino formate;1-hexylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 155715085 |
| Molecular Formula | C17H28N2O6 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | butanedial;dimethylamino formate;1-hexylpyrrole-2,5-dione |
| SMILES | CCCCCCN1C(=O)C=CC1=O.CN(C)OC=O.O=CCCC=O |
| InChI | InChI=1S/C10H15NO2.C4H6O2.C3H7NO2/c1-2-3-4-5-8-11-9(12)6-7-10(11)13;5-3-1-2-4-6;1-4(2)6-3-5/h6-7H,2-5,8H2,1H3;3-4H,1-2H2;3H,1-2H3 |
| InChIKey | YLSJHNZFUIPXOZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|