C15H26N2O6 — CID 169183807
butanedial;N-methoxy-N-methylmethanamine;(Z)-N-methyl-4-oxo-N-(3-oxopropyl)but-2-enamide (PubChem CID 169183807) has the molecular formula C15H26N2O6 and a molecular weight of 330.38 g/mol. Its IUPAC name is butanedial;N-methoxy-N-methylmethanamine;(Z)-N-methyl-4-oxo-N-(3-oxopropyl)but-2-enamide.
| Compound Name | butanedial;N-methoxy-N-methylmethanamine;(Z)-N-methyl-4-oxo-N-(3-oxopropyl)but-2-enamide |
|---|---|
| PubChem CID | 169183807 |
| Molecular Formula | C15H26N2O6 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | butanedial;N-methoxy-N-methylmethanamine;(Z)-N-methyl-4-oxo-N-(3-oxopropyl)but-2-enamide |
| SMILES | CN(CCC=O)C(=O)/C=C\C=O.CON(C)C.O=CCCC=O |
| InChI | InChI=1S/C8H11NO3.C4H6O2.C3H9NO/c1-9(5-3-7-11)8(12)4-2-6-10;5-3-1-2-4-6;1-4(2)5-3/h2,4,6-7H,3,5H2,1H3;3-4H,1-2H2;1-3H3/b4-2-;; |
| InChIKey | AZAZLZYIBPSURB-IUDDPPFWSA-N |
| XLogP | 0.06 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|