C16H26N2O6 — CID 165406967
(2,5-dioxopyrrolidin-1-yl) acetate;ethane;(Z)-N-methyl-4-oxo-N-propan-2-ylbut-2-enamide (PubChem CID 165406967) has the molecular formula C16H26N2O6 and a molecular weight of 342.39 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) acetate;ethane;(Z)-N-methyl-4-oxo-N-propan-2-ylbut-2-enamide.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) acetate;ethane;(Z)-N-methyl-4-oxo-N-propan-2-ylbut-2-enamide |
|---|---|
| PubChem CID | 165406967 |
| Molecular Formula | C16H26N2O6 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) acetate;ethane;(Z)-N-methyl-4-oxo-N-propan-2-ylbut-2-enamide |
| SMILES | CC.CC(=O)ON1C(=O)CCC1=O.CC(C)N(C)C(=O)/C=C\C=O |
| InChI | InChI=1S/C8H13NO2.C6H7NO4.C2H6/c1-7(2)9(3)8(11)5-4-6-10;1-4(8)11-7-5(9)2-3-6(7)10;1-2/h4-7H,1-3H3;2-3H2,1H3;1-2H3/b5-4-;; |
| InChIKey | COLFPVYGKFXCTA-WNCVTPEDSA-N |
| XLogP | 1.25 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|