C10H12N2O6 — CID 139549851
N-[(2,5-dioxopyrrol-1-yl)oxymethoxy]-N-methyl-4-oxobutanamide (PubChem CID 139549851) has the molecular formula C10H12N2O6 and a molecular weight of 256.21 g/mol. Its IUPAC name is N-[(2,5-dioxopyrrol-1-yl)oxymethoxy]-N-methyl-4-oxobutanamide.
| Compound Name | N-[(2,5-dioxopyrrol-1-yl)oxymethoxy]-N-methyl-4-oxobutanamide |
|---|---|
| PubChem CID | 139549851 |
| Molecular Formula | C10H12N2O6 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | N-[(2,5-dioxopyrrol-1-yl)oxymethoxy]-N-methyl-4-oxobutanamide |
| SMILES | CN(OCON1C(=O)C=CC1=O)C(=O)CCC=O |
| InChI | InChI=1S/C10H12N2O6/c1-11(8(14)3-2-6-13)17-7-18-12-9(15)4-5-10(12)16/h4-6H,2-3,7H2,1H3 |
| InChIKey | XQQPJYBWLVFGCU-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|