C11H12N2O6 — CID 89150559
[methyl(4-oxobutanoyl)amino] 2-(2,5-dioxopyrrol-1-yl)acetate (PubChem CID 89150559) has the molecular formula C11H12N2O6 and a molecular weight of 268.22 g/mol. Its IUPAC name is [methyl(4-oxobutanoyl)amino] 2-(2,5-dioxopyrrol-1-yl)acetate.
| Compound Name | [methyl(4-oxobutanoyl)amino] 2-(2,5-dioxopyrrol-1-yl)acetate |
|---|---|
| PubChem CID | 89150559 |
| Molecular Formula | C11H12N2O6 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | [methyl(4-oxobutanoyl)amino] 2-(2,5-dioxopyrrol-1-yl)acetate |
| SMILES | CN(OC(=O)CN1C(=O)C=CC1=O)C(=O)CCC=O |
| InChI | InChI=1S/C11H12N2O6/c1-12(8(15)3-2-6-14)19-11(18)7-13-9(16)4-5-10(13)17/h4-6H,2-3,7H2,1H3 |
| InChIKey | OYUSFFNNOKBHSG-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|