About tert-butyl 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfamoylamino]butanoate
tert-butyl 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfamoylamino]butanoate (PubChem CID 118426393) has the molecular formula C15H25N3O6S
and a molecular weight of 375.45 g/mol. Its IUPAC name is tert-butyl 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfamoylamino]butanoate.
Molecular Properties
| Compound Name | tert-butyl 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfamoylamino]butanoate |
| PubChem CID | 118426393 |
| Molecular Formula | C15H25N3O6S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | tert-butyl 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfamoylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCNS(=O)(=O)NCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H25N3O6S/c1-15(2,3)24-14(21)6-4-9-16-25(22,23)17-10-5-11-18-12(19)7-8-13(18)20/h7-8,16-17H,4-6,9-11H2,1-3H3 |
| InChIKey | LEJOCOCOOQHOFW-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfamoylamino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfamoylamino]butanoate?
The IUPAC name of tert-butyl 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfamoylamino]butanoate (CID 118426393) is tert-butyl 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfamoylamino]butanoate.
What is the SMILES notation for tert-butyl 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfamoylamino]butanoate?
The canonical SMILES for tert-butyl 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfamoylamino]butanoate is CC(C)(C)OC(=O)CCCNS(=O)(=O)NCCCN1C(=O)C=CC1=O.
What is the InChIKey of tert-butyl 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfamoylamino]butanoate?
The InChIKey is LEJOCOCOOQHOFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O6S/c1-15(2,3)24-14(21)6-4-9-16-25(22,23)17-10-5-11-18-12(19)7-8-13(18)20/h7-8,16-17H,4-6,9-11H2,1-3H3.
What are the key properties of tert-butyl 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfamoylamino]butanoate?
tert-butyl 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfamoylamino]butanoate has a molecular weight of 375.45 g/mol, XLogP of -0.15, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfamoylamino]butanoate is sourced from PubChem (CID 118426393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).