C15H25N3O5S — CID 118426391
tert-butyl 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfinamoylamino]butanoate (PubChem CID 118426391) has the molecular formula C15H25N3O5S and a molecular weight of 359.45 g/mol. Its IUPAC name is tert-butyl 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfinamoylamino]butanoate.
| Compound Name | tert-butyl 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfinamoylamino]butanoate |
|---|---|
| PubChem CID | 118426391 |
| Molecular Formula | C15H25N3O5S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | tert-butyl 4-[3-(2,5-dioxopyrrol-1-yl)propylsulfinamoylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCNS(=O)NCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H25N3O5S/c1-15(2,3)23-14(21)6-4-9-16-24(22)17-10-5-11-18-12(19)7-8-13(18)20/h7-8,16-17H,4-6,9-11H2,1-3H3 |
| InChIKey | XWZLELGWVLIDTF-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|