C13H19NO6S — CID 134451515
tert-butyl 2-[3-(2,5-dioxopyrrol-1-yl)propylsulfonyl]acetate (PubChem CID 134451515) has the molecular formula C13H19NO6S and a molecular weight of 317.36 g/mol. Its IUPAC name is tert-butyl 2-[3-(2,5-dioxopyrrol-1-yl)propylsulfonyl]acetate.
| Compound Name | tert-butyl 2-[3-(2,5-dioxopyrrol-1-yl)propylsulfonyl]acetate |
|---|---|
| PubChem CID | 134451515 |
| Molecular Formula | C13H19NO6S |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | tert-butyl 2-[3-(2,5-dioxopyrrol-1-yl)propylsulfonyl]acetate |
| SMILES | CC(C)(C)OC(=O)CS(=O)(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H19NO6S/c1-13(2,3)20-12(17)9-21(18,19)8-4-7-14-10(15)5-6-11(14)16/h5-6H,4,7-9H2,1-3H3 |
| InChIKey | AJRWMVGWQXIMOM-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|