C16H19N3O14S3 — CID 159500977
4-(2,5-dioxopyrrol-1-yl)butanoic acid;(sulfanylamino) 4-(2,5-dioxopyrrol-1-yl)butanoate;bis(sulfur trioxide) (PubChem CID 159500977) has the molecular formula C16H19N3O14S3 and a molecular weight of 573.54 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)butanoic acid;(sulfanylamino) 4-(2,5-dioxopyrrol-1-yl)butanoate;bis(sulfur trioxide).
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)butanoic acid;(sulfanylamino) 4-(2,5-dioxopyrrol-1-yl)butanoate;bis(sulfur trioxide) |
|---|---|
| PubChem CID | 159500977 |
| Molecular Formula | C16H19N3O14S3 |
| Molecular Weight | 573.54 g/mol |
| Exact Mass | 573.00 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)butanoic acid;(sulfanylamino) 4-(2,5-dioxopyrrol-1-yl)butanoate;bis(sulfur trioxide) |
| SMILES | O=C(CCCN1C(=O)C=CC1=O)ONS.O=C(O)CCCN1C(=O)C=CC1=O.O=S(=O)=O.O=S(=O)=O |
| InChI | InChI=1S/C8H10N2O4S.C8H9NO4.2O3S/c11-6-3-4-7(12)10(6)5-1-2-8(13)14-9-15;10-6-3-4-7(11)9(6)5-1-2-8(12)13;2*1-4(2)3/h3-4,9,15H,1-2,5H2;3-4H,1-2,5H2,(H,12,13);; |
| InChIKey | LZJPBQHMGQYUJR-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 252.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.54 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|